CAS 1131614-19-1
:3-Iodo-4-(2-methylpropoxy)benzoic acid
Description:
3-Iodo-4-(2-methylpropoxy)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an iodine atom and a 2-methylpropoxy group. The presence of the iodine atom introduces notable properties, such as increased molecular weight and potential for enhanced reactivity in certain chemical reactions, including electrophilic substitutions. The 2-methylpropoxy group contributes to the compound's hydrophobic characteristics, influencing its solubility in organic solvents while potentially limiting its solubility in water. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Additionally, the presence of the carboxylic acid functional group allows for potential interactions with biological targets, such as enzymes or receptors. Overall, 3-Iodo-4-(2-methylpropoxy)benzoic acid is a compound with unique structural attributes that may lend itself to various applications in research and industry, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C11H13IO3
InChI:InChI=1S/C11H13IO3/c1-7(2)6-15-10-4-3-8(11(13)14)5-9(10)12/h3-5,7H,6H2,1-2H3,(H,13,14)
InChI key:InChIKey=AOVWUOOHZQQYPC-UHFFFAOYSA-N
SMILES:O(CC(C)C)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:- 3-Iodo-4-(2-methylpropoxy)benzoic acid
- Benzoic acid, 3-iodo-4-(2-methylpropoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
