
CAS 1131614-21-5
:3-Iodo-4-[(1-methylethoxy)methyl]benzoic acid
Description:
3-Iodo-4-[(1-methylethoxy)methyl]benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an iodine atom and an alkoxy group. The presence of the iodine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The 1-methylethoxy group contributes to the compound's hydrophobic characteristics, potentially affecting its solubility and interaction with biological membranes. This compound may exhibit unique properties due to the combination of its functional groups, which can influence its acidity, polarity, and overall reactivity. Additionally, the presence of the carboxylic acid functional group allows for potential hydrogen bonding and interactions with other molecules, which is significant in biological systems. Overall, 3-Iodo-4-[(1-methylethoxy)methyl]benzoic acid is a compound that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C11H13IO3
InChI:InChI=1S/C11H13IO3/c1-7(2)15-6-9-4-3-8(11(13)14)5-10(9)12/h3-5,7H,6H2,1-2H3,(H,13,14)
InChI key:InChIKey=QLKYLIUQQCVGJU-UHFFFAOYSA-N
SMILES:C(OC(C)C)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:- 3-Iodo-4-[(1-methylethoxy)methyl]benzoic acid
- Benzoic acid, 3-iodo-4-[(1-methylethoxy)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
