CymitQuimica logo

CAS 1131614-24-8

:

4-Cyclohexyl-3-iodobenzoic acid

Description:
4-Cyclohexyl-3-iodobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a cyclohexyl group and an iodine atom. The presence of the cyclohexyl group contributes to its hydrophobic characteristics, while the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The iodine substituent enhances the compound's reactivity, making it useful in synthetic organic chemistry, particularly in halogenation reactions. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the solvent's polarity. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as iodine-containing compounds can pose health risks. Overall, 4-Cyclohexyl-3-iodobenzoic acid is a versatile compound with unique properties stemming from its functional groups and substituents.
Formula:C13H15IO2
InChI:InChI=1S/C13H15IO2/c14-12-8-10(13(15)16)6-7-11(12)9-4-2-1-3-5-9/h6-9H,1-5H2,(H,15,16)
InChI key:InChIKey=UCLIQBXTCVLQMT-UHFFFAOYSA-N
SMILES:IC1=C(C=CC(C(O)=O)=C1)C2CCCCC2
Synonyms:
  • Benzoic acid, 4-cyclohexyl-3-iodo-
  • 4-Cyclohexyl-3-iodobenzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.