CAS 1131614-26-0
:3-Iodo-4-(1-piperidinyl)benzoic acid
Description:
3-Iodo-4-(1-piperidinyl)benzoic acid is a chemical compound characterized by its structure, which includes a benzoic acid moiety substituted with an iodine atom and a piperidine group. The presence of the iodine atom typically enhances the compound's reactivity and can influence its biological activity. The piperidine ring, a six-membered nitrogen-containing heterocycle, contributes to the compound's potential as a pharmacophore, making it of interest in medicinal chemistry. This compound may exhibit properties such as lipophilicity due to the aromatic system, which can affect its solubility and permeability in biological systems. Additionally, the carboxylic acid functional group is likely to impart acidic characteristics, influencing its behavior in various chemical environments. Overall, 3-Iodo-4-(1-piperidinyl)benzoic acid is a compound that may have applications in drug development and research, particularly in areas targeting specific biological pathways or receptors. Its unique structural features make it a candidate for further investigation in pharmacological studies.
Formula:C12H14INO2
InChI:InChI=1S/C12H14INO2/c13-10-8-9(12(15)16)4-5-11(10)14-6-2-1-3-7-14/h4-5,8H,1-3,6-7H2,(H,15,16)
InChI key:InChIKey=ZDLDTTZAZFNPRI-UHFFFAOYSA-N
SMILES:IC1=C(C=CC(C(O)=O)=C1)N2CCCCC2
Synonyms:- Benzoic acid, 3-iodo-4-(1-piperidinyl)-
- 3-Iodo-4-(1-piperidinyl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
