CAS 1131614-30-6
:4-(Cyclopentyloxy)-3-iodobenzoic acid
Description:
4-(Cyclopentyloxy)-3-iodobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both a cyclopentyloxy group and an iodine atom. The presence of the cyclopentyloxy group introduces a cyclic ether functionality, contributing to the compound's hydrophobic characteristics and potentially influencing its solubility and reactivity. The iodine substituent enhances the compound's electrophilic nature, making it useful in various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in materials science and organic synthesis, particularly in the development of novel pharmaceuticals or agrochemicals. The compound's properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment. Overall, 4-(Cyclopentyloxy)-3-iodobenzoic acid represents a versatile building block in organic synthesis with potential applications across multiple fields.
Formula:C12H13IO3
InChI:InChI=1S/C12H13IO3/c13-10-7-8(12(14)15)5-6-11(10)16-9-3-1-2-4-9/h5-7,9H,1-4H2,(H,14,15)
InChI key:InChIKey=FUQGPVIVCOUPRE-UHFFFAOYSA-N
SMILES:O(C1=C(I)C=C(C(O)=O)C=C1)C2CCCC2
Synonyms:- Benzoic acid, 4-(cyclopentyloxy)-3-iodo-
- 4-(Cyclopentyloxy)-3-iodobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
