CymitQuimica logo

CAS 1131614-32-8

:

Methyl 3-iodo-4-pentylbenzoate

Description:
Methyl 3-iodo-4-pentylbenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a methyl ester group and a pentyl side chain, contributing to its hydrophobic properties. The presence of the iodine atom at the 3-position of the aromatic ring enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. This compound is typically a colorless to pale yellow liquid, exhibiting moderate solubility in organic solvents while being less soluble in water due to its hydrophobic nature. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the iodine substituent may impart unique properties, such as increased lipophilicity or altered biological activity. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, Methyl 3-iodo-4-pentylbenzoate is a versatile compound with interesting chemical properties suitable for further research and application in various fields.
Formula:C13H17IO2
InChI:InChI=1S/C13H17IO2/c1-3-4-5-6-10-7-8-11(9-12(10)14)13(15)16-2/h7-9H,3-6H2,1-2H3
InChI key:InChIKey=CADHUILPRGYYBE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(I)=C(CCCCC)C=C1
Synonyms:
  • Methyl 3-iodo-4-pentylbenzoate
  • Benzoic acid, 3-iodo-4-pentyl-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.