
CAS 1131614-36-2
:3-Iodo-4-(4-morpholinyl)benzoic acid
Description:
3-Iodo-4-(4-morpholinyl)benzoic acid is an organic compound characterized by its structure, which includes a benzoic acid moiety substituted with an iodine atom and a morpholine group. The presence of the iodine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The morpholine group, a six-membered ring containing both oxygen and nitrogen, contributes to the compound's solubility and potential interactions with biological targets. This compound is typically a white to off-white solid and is soluble in polar solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific receptors or enzymes. Additionally, the compound may exhibit unique properties such as antimicrobial or anti-inflammatory activities, although specific biological activities would require empirical investigation. Safety data and handling precautions should be observed, as with any chemical substance, particularly those containing halogens and heteroatoms.
Formula:C11H12INO3
InChI:InChI=1S/C11H12INO3/c12-9-7-8(11(14)15)1-2-10(9)13-3-5-16-6-4-13/h1-2,7H,3-6H2,(H,14,15)
InChI key:InChIKey=GYGVFWOCCCWANL-UHFFFAOYSA-N
SMILES:IC1=C(C=CC(C(O)=O)=C1)N2CCOCC2
Synonyms:- 3-Iodo-4-morpholinobenzoic acid
- 3-Iodo-4-(4-morpholinyl)benzoic acid
- Benzoic acid, 3-iodo-4-(4-morpholinyl)-
- 3-Iodo-4-morpholinobenzoicacid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
