CAS 1131614-40-8
:Ethyl 4-(acetyloxy)-3-iodobenzoate
Description:
Ethyl 4-(acetyloxy)-3-iodobenzoate is an organic compound characterized by its ester functional group and the presence of an iodine atom, which contributes to its reactivity and potential applications in organic synthesis. The structure features a benzoate moiety with an ethyl group and an acetyloxy substituent, indicating that it is an ester derived from benzoic acid. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic ring. The presence of the iodine atom can enhance its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the acetyloxy group can serve as a leaving group in reactions, further expanding its utility in synthetic chemistry. Ethyl 4-(acetyloxy)-3-iodobenzoate may also possess biological activity, which could be explored in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential hazards associated with its chemical properties.
Formula:C11H11IO4
InChI:InChI=1S/C11H11IO4/c1-3-15-11(14)8-4-5-10(9(12)6-8)16-7(2)13/h4-6H,3H2,1-2H3
InChI key:InChIKey=SGENPJBJKKECIT-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC(I)=C(OC(C)=O)C=C1
Synonyms:- Ethyl 4-(acetyloxy)-3-iodobenzoate
- Benzoic acid, 4-(acetyloxy)-3-iodo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
