CAS 1131614-41-9
:3-Iodo-4-(pentyloxy)benzoic acid
Description:
3-Iodo-4-(pentyloxy)benzoic acid is an organic compound characterized by the presence of an iodo substituent and a pentyloxy group attached to a benzoic acid framework. The iodo group, located at the meta position relative to the carboxylic acid, enhances the compound's reactivity and can influence its biological activity. The pentyloxy group, which is a five-carbon alkoxy chain, contributes to the compound's hydrophobic characteristics, potentially affecting its solubility and interaction with biological membranes. This compound may exhibit interesting properties in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the carboxylic acid and the halogen substituent, which can participate in various chemical reactions. Additionally, the structural features suggest potential applications in materials science or as a building block in organic synthesis. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used.
Formula:C12H15IO3
InChI:InChI=1S/C12H15IO3/c1-2-3-4-7-16-11-6-5-9(12(14)15)8-10(11)13/h5-6,8H,2-4,7H2,1H3,(H,14,15)
InChI key:InChIKey=BGOAIPSNPARGNA-UHFFFAOYSA-N
SMILES:O(CCCCC)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:- Benzoic acid, 3-iodo-4-(pentyloxy)-
- 3-Iodo-4-(pentyloxy)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
