CAS 1131614-42-0
:Methyl 4-butoxy-3-iodobenzoate
Description:
Methyl 4-butoxy-3-iodobenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a methyl ester group, a butoxy substituent, and an iodine atom attached to the aromatic ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. Its molecular structure contributes to its solubility in organic solvents, while its iodine substituent may impart unique reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The presence of the butoxy group enhances its hydrophobic characteristics, potentially affecting its biological activity and interactions with other substances. Methyl 4-butoxy-3-iodobenzoate may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its functional groups that allow for further chemical modifications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H15IO3
InChI:InChI=1S/C12H15IO3/c1-3-4-7-16-11-6-5-9(8-10(11)13)12(14)15-2/h5-6,8H,3-4,7H2,1-2H3
InChI key:InChIKey=PAHXWHWIINWWBX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(I)=C(OCCCC)C=C1
Synonyms:- Methyl 4-butoxy-3-iodobenzoate
- Benzoic acid, 4-butoxy-3-iodo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
