CymitQuimica logo

CAS 1131614-48-6

:

4-(2,2-Dimethylpropoxy)-3-iodobenzoic acid

Description:
4-(2,2-Dimethylpropoxy)-3-iodobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both an iodine atom and a branched alkoxy group. The presence of the iodine atom typically imparts unique reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The 2,2-dimethylpropoxy group contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit moderate to high lipophilicity due to the bulky alkoxy substituent, which can affect its pharmacokinetic properties if used in drug development. Additionally, the carboxylic acid functional group provides acidic properties, allowing for potential ionization in aqueous environments, which can further influence its behavior in biological systems. Overall, the combination of these functional groups makes 4-(2,2-Dimethylpropoxy)-3-iodobenzoic acid a compound of interest in various chemical research fields.
Formula:C12H15IO3
InChI:InChI=1S/C12H15IO3/c1-12(2,3)7-16-10-5-4-8(11(14)15)6-9(10)13/h4-6H,7H2,1-3H3,(H,14,15)
InChI key:InChIKey=HJNAVQGQTUEWCF-UHFFFAOYSA-N
SMILES:O(CC(C)(C)C)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:
  • 4-(2,2-Dimethylpropoxy)-3-iodobenzoic acid
  • Benzoic acid, 4-(2,2-dimethylpropoxy)-3-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.