CymitQuimica logo

CAS 1131614-49-7

:

3-Iodo-4-[(2-methoxyacetyl)amino]benzoic acid

Description:
3-Iodo-4-[(2-methoxyacetyl)amino]benzoic acid is an organic compound characterized by its complex structure, which includes an iodo substituent, an amino group, and a carboxylic acid functional group. The presence of the iodine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The methoxyacetyl group contributes to the compound's solubility and stability, potentially affecting its pharmacokinetic properties. This compound is likely to exhibit polar characteristics due to the carboxylic acid and methoxy groups, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in drug development, particularly in the synthesis of pharmaceuticals targeting specific biological pathways. Additionally, the compound's unique functional groups may allow for further derivatization, expanding its utility in various chemical reactions. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of iodine, which can be hazardous in certain concentrations.
Formula:C10H10INO4
InChI:InChI=1S/C10H10INO4/c1-16-5-9(13)12-8-3-2-6(10(14)15)4-7(8)11/h2-4H,5H2,1H3,(H,12,13)(H,14,15)
InChI key:InChIKey=AZMWCQFPCCJYTG-UHFFFAOYSA-N
SMILES:N(C(COC)=O)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:
  • 3-Iodo-4-[(2-methoxyacetyl)amino]benzoic acid
  • Benzoic acid, 3-iodo-4-[(2-methoxyacetyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.