CAS 1131614-52-2
:4-(2-Ethoxyethoxy)-3-iodobenzoic acid
Description:
4-(2-Ethoxyethoxy)-3-iodobenzoic acid is an organic compound characterized by its benzoic acid structure, which includes an iodine atom and an ethoxyethoxy substituent. This compound features a benzene ring with a carboxylic acid group (-COOH) at one position and an iodine atom at the meta position relative to the carboxylic acid. The ethoxyethoxy group, which consists of two ethoxy (-OCH2CH3) units linked by an ether bond, contributes to the compound's solubility and polarity. The presence of the iodine atom enhances the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit interesting biological properties, potentially making it relevant in pharmaceutical applications. Its molecular structure suggests that it may participate in hydrogen bonding due to the carboxylic acid group, influencing its physical properties such as melting point and solubility in different solvents. Overall, 4-(2-Ethoxyethoxy)-3-iodobenzoic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C11H13IO4
InChI:InChI=1S/C11H13IO4/c1-2-15-5-6-16-10-4-3-8(11(13)14)7-9(10)12/h3-4,7H,2,5-6H2,1H3,(H,13,14)
InChI key:InChIKey=QHICQURDLYIYEF-UHFFFAOYSA-N
SMILES:O(CCOCC)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:- 4-(2-Ethoxyethoxy)-3-iodobenzoic acid
- Benzoic acid, 4-(2-ethoxyethoxy)-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
