CymitQuimica logo

CAS 1131614-55-5

:

Methyl 4-cyclohexyl-3-iodobenzoate

Description:
Methyl 4-cyclohexyl-3-iodobenzoate is an organic compound characterized by its ester functional group, which is formed from the reaction of benzoic acid and methanol, with a cyclohexyl group and an iodine atom substituted on the aromatic ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It has a relatively low solubility in water but is soluble in organic solvents such as ethanol and dichloromethane. The presence of the iodine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the cyclohexyl group can influence the compound's steric and electronic properties, affecting its behavior in chemical reactions and interactions with biological systems. Methyl 4-cyclohexyl-3-iodobenzoate may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C14H17IO2
InChI:InChI=1S/C14H17IO2/c1-17-14(16)11-7-8-12(13(15)9-11)10-5-3-2-4-6-10/h7-10H,2-6H2,1H3
InChI key:InChIKey=XDSOINVKKGOQNZ-UHFFFAOYSA-N
SMILES:IC1=C(C=CC(C(OC)=O)=C1)C2CCCCC2
Synonyms:
  • Methyl 4-cyclohexyl-3-iodobenzoate
  • Benzoic acid, 4-cyclohexyl-3-iodo-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.