CAS 1131614-56-6
:Methyl 3-iodo-4-(1-pyrrolidinylmethyl)benzoate
Description:
Methyl 3-iodo-4-(1-pyrrolidinylmethyl)benzoate is a chemical compound characterized by its unique structure, which includes a benzoate moiety substituted with an iodine atom and a pyrrolidinylmethyl group. This compound features a methyl ester functional group, which contributes to its solubility in organic solvents. The presence of the iodine atom enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The pyrrolidinylmethyl substituent may impart specific biological activities, as pyrrolidine derivatives are often associated with pharmacological properties. The compound's molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, its CAS number, 1131614-56-6, allows for easy identification and reference in chemical databases. Overall, Methyl 3-iodo-4-(1-pyrrolidinylmethyl)benzoate is a compound with potential applications in research and industry, particularly in the fields of organic synthesis and drug development.
Formula:C13H16INO2
InChI:InChI=1S/C13H16INO2/c1-17-13(16)10-4-5-11(12(14)8-10)9-15-6-2-3-7-15/h4-5,8H,2-3,6-7,9H2,1H3
InChI key:InChIKey=UOJAHYKURPKSQU-UHFFFAOYSA-N
SMILES:C(C1=C(I)C=C(C(OC)=O)C=C1)N2CCCC2
Synonyms:- Methyl 3-iodo-4-(1-pyrrolidinylmethyl)benzoate
- Benzoic acid, 3-iodo-4-(1-pyrrolidinylmethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
