
CAS 1131614-59-9
:3-Iodo-4-(2-methyl-1-piperidinyl)benzoic acid
Description:
3-Iodo-4-(2-methyl-1-piperidinyl)benzoic acid is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with an iodine atom and a piperidine ring. The presence of the iodine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The piperidine group, which is a six-membered nitrogen-containing ring, contributes to the compound's potential pharmacological properties, including its ability to interact with various biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its functional groups suggest potential applications in drug development, particularly in the synthesis of compounds with therapeutic effects. Additionally, the presence of both the carboxylic acid and the piperidine nitrogen can facilitate hydrogen bonding, which may play a role in its interactions with biological systems. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C13H16INO2
InChI:InChI=1S/C13H16INO2/c1-9-4-2-3-7-15(9)12-6-5-10(13(16)17)8-11(12)14/h5-6,8-9H,2-4,7H2,1H3,(H,16,17)
InChI key:InChIKey=CTQVEGJPJVTGPH-UHFFFAOYSA-N
SMILES:IC1=C(C=CC(C(O)=O)=C1)N2C(C)CCCC2
Synonyms:- Benzoic acid, 3-iodo-4-(2-methyl-1-piperidinyl)-
- 3-Iodo-4-(2-methyl-1-piperidinyl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
