CymitQuimica logo

CAS 1131614-60-2

:

3-Iodo-4-(3-methyl-1-piperidinyl)benzoic acid

Description:
3-Iodo-4-(3-methyl-1-piperidinyl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with an iodine atom and a piperidine ring. The presence of the iodine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The piperidine ring, which contains a nitrogen atom, contributes to the compound's potential as a pharmacophore, possibly affecting its interaction with biological targets. This compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the aromatic ring and the piperidine structure. Its acidic functional group (carboxylic acid) can participate in hydrogen bonding, influencing its overall chemical behavior. Additionally, the compound may exhibit specific pharmacological properties, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.
Formula:C13H16INO2
InChI:InChI=1S/C13H16INO2/c1-9-3-2-6-15(8-9)12-5-4-10(13(16)17)7-11(12)14/h4-5,7,9H,2-3,6,8H2,1H3,(H,16,17)
InChI key:InChIKey=UCMDMVVSPHRIGO-UHFFFAOYSA-N
SMILES:IC1=C(N2CC(C)CCC2)C=CC(C(O)=O)=C1
Synonyms:
  • 3-Iodo-4-(3-methyl-1-piperidinyl)benzoic acid
  • Benzoic acid, 3-iodo-4-(3-methyl-1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.