CAS 1131614-62-4
:4-(Cyclohexylamino)-3-iodobenzoic acid
Description:
4-(Cyclohexylamino)-3-iodobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both a cyclohexylamino group and an iodine atom. The presence of the cyclohexylamino group contributes to its potential as a biological or pharmaceutical agent, as amines often play crucial roles in drug design due to their ability to form hydrogen bonds and interact with biological targets. The iodine substitution on the benzene ring can enhance the compound's lipophilicity and may influence its reactivity and biological activity. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water, typical of many aromatic compounds. Additionally, the presence of both an amino group and a carboxylic acid group suggests that it can participate in various chemical reactions, including amide formation and acid-base reactions. Overall, 4-(Cyclohexylamino)-3-iodobenzoic acid is of interest in medicinal chemistry and may have applications in the development of therapeutic agents.
Formula:C13H16INO2
InChI:InChI=1S/C13H16INO2/c14-11-8-9(13(16)17)6-7-12(11)15-10-4-2-1-3-5-10/h6-8,10,15H,1-5H2,(H,16,17)
InChI key:InChIKey=QLQFFHQEYDKAII-UHFFFAOYSA-N
SMILES:N(C1=C(I)C=C(C(O)=O)C=C1)C2CCCCC2
Synonyms:- Benzoic acid, 4-(cyclohexylamino)-3-iodo-
- 4-(Cyclohexylamino)-3-iodobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
