
CAS 1131614-64-6
:Methyl 3-iodo-4-(3-piperidinyl)benzoate
Description:
Methyl 3-iodo-4-(3-piperidinyl)benzoate is a chemical compound characterized by its structure, which includes a benzoate moiety substituted with an iodine atom and a piperidine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, such as moderate solubility in organic solvents and potential reactivity due to the presence of the iodine substituent, which can participate in nucleophilic substitution reactions. The piperidine group contributes to its basicity and may influence its interaction with biological targets, making it of interest in medicinal chemistry. The presence of the methyl ester functional group suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid. Additionally, the compound may exhibit specific pharmacological activities, depending on its interactions with biological systems, which could be explored in drug development contexts. Overall, Methyl 3-iodo-4-(3-piperidinyl)benzoate is a compound of interest for its potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C13H16INO2
InChI:InChI=1S/C13H16INO2/c1-17-13(16)9-4-5-11(12(14)7-9)10-3-2-6-15-8-10/h4-5,7,10,15H,2-3,6,8H2,1H3
InChI key:InChIKey=LYENAGSBIGZHOX-UHFFFAOYSA-N
SMILES:IC1=C(C=CC(C(OC)=O)=C1)C2CCCNC2
Synonyms:- Benzoic acid, 3-iodo-4-(3-piperidinyl)-, methyl ester
- Methyl 3-iodo-4-(3-piperidinyl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
