CAS 1131614-70-4
:4-Heptyl-3-iodobenzoic acid
Description:
4-Heptyl-3-iodobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a heptyl group and an iodine atom. The presence of the heptyl group, a straight-chain alkyl group with seven carbon atoms, contributes to its hydrophobic characteristics, while the carboxylic acid functional group (-COOH) imparts acidic properties and enhances solubility in polar solvents. The iodine substitution at the 3-position of the aromatic ring introduces significant steric and electronic effects, which can influence the compound's reactivity and interaction with biological systems. This compound may exhibit interesting properties such as potential applications in pharmaceuticals, materials science, or as a reagent in organic synthesis. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions or coupling reactions, making it a valuable compound for research and development in organic chemistry. As with many iodinated compounds, it may also have implications in imaging or labeling applications in biochemistry.
Formula:C14H19IO2
InChI:InChI=1S/C14H19IO2/c1-2-3-4-5-6-7-11-8-9-12(14(16)17)10-13(11)15/h8-10H,2-7H2,1H3,(H,16,17)
InChI key:InChIKey=ZHLGDXUHUDXKDL-UHFFFAOYSA-N
SMILES:C(CCCCCC)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:- Benzoic acid, 4-heptyl-3-iodo-
- 4-Heptyl-3-iodobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
