
CAS 1131614-71-5
:Ethyl 3-iodo-4-pentylbenzoate
Description:
Ethyl 3-iodo-4-pentylbenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. The presence of the iodine atom at the 3-position of the aromatic ring and a pentyl group at the 4-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents, reflecting its hydrophobic nature due to the long pentyl chain. Ethyl 3-iodo-4-pentylbenzoate may exhibit moderate to high reactivity in nucleophilic substitution reactions due to the presence of the iodine atom, which is a good leaving group. Additionally, its structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, this compound is of interest in various fields of chemical research and applications.
Formula:C14H19IO2
InChI:InChI=1S/C14H19IO2/c1-3-5-6-7-11-8-9-12(10-13(11)15)14(16)17-4-2/h8-10H,3-7H2,1-2H3
InChI key:InChIKey=VSRMMQFUCDQJFN-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC(I)=C(CCCCC)C=C1
Synonyms:- Ethyl 3-iodo-4-pentylbenzoate
- Benzoic acid, 3-iodo-4-pentyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
