
CAS 1131614-75-9
:Butyl 4-(dimethylamino)-3-iodobenzoate
Description:
Butyl 4-(dimethylamino)-3-iodobenzoate is an organic compound characterized by its ester functional group, which is formed from the reaction of butanol and 4-(dimethylamino)-3-iodobenzoic acid. This compound features a butyl group, a dimethylamino group, and an iodine atom attached to a benzene ring, contributing to its unique chemical properties. It is typically a solid or liquid at room temperature, depending on its specific formulation and purity. The presence of the iodine atom enhances its reactivity, making it useful in various chemical synthesis applications, particularly in medicinal chemistry and organic synthesis. The dimethylamino group can impart basic properties, influencing its solubility in different solvents. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as compounds with halogen substituents can pose specific health and environmental risks. Overall, Butyl 4-(dimethylamino)-3-iodobenzoate is a versatile compound with potential applications in various fields of chemistry.
Formula:C13H18INO2
InChI:InChI=1S/C13H18INO2/c1-4-5-8-17-13(16)10-6-7-12(15(2)3)11(14)9-10/h6-7,9H,4-5,8H2,1-3H3
InChI key:InChIKey=QMKUIPSSRYATLU-UHFFFAOYSA-N
SMILES:C(OCCCC)(=O)C1=CC(I)=C(N(C)C)C=C1
Synonyms:- Butyl 4-(dimethylamino)-3-iodobenzoate
- Benzoic acid, 4-(dimethylamino)-3-iodo-, butyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
