CAS 1131614-76-0
:4-(2,2-Dimethyl-1-oxopropoxy)-3-iodobenzoic acid
Description:
4-(2,2-Dimethyl-1-oxopropoxy)-3-iodobenzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with an iodine atom and an ether functional group. The presence of the 2,2-dimethyl-1-oxopropoxy group contributes to its hydrophobic characteristics, while the carboxylic acid group imparts acidic properties. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to the bulky substituents. Its iodine substitution may enhance its reactivity in certain chemical reactions, making it a potential candidate for various synthetic applications. Additionally, the compound may possess biological activity, which could be explored in pharmaceutical research. Safety and handling precautions should be observed, as with many organic compounds, particularly those containing halogens and functional groups that may pose health risks. Overall, 4-(2,2-Dimethyl-1-oxopropoxy)-3-iodobenzoic acid represents a complex organic molecule with potential utility in both chemical synthesis and biological applications.
Formula:C12H13IO4
InChI:InChI=1S/C12H13IO4/c1-12(2,3)11(16)17-9-5-4-7(10(14)15)6-8(9)13/h4-6H,1-3H3,(H,14,15)
InChI key:InChIKey=ASTPVDODZJLOLA-UHFFFAOYSA-N
SMILES:O(C(C(C)(C)C)=O)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:- 4-(2,2-Dimethyl-1-oxopropoxy)-3-iodobenzoic acid
- Benzoic acid, 4-(2,2-dimethyl-1-oxopropoxy)-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
