CAS 1131614-77-1
:3-Iodo-4-[(tetrahydro-2H-pyran-4-yl)oxy]benzoic acid
Description:
3-Iodo-4-[(tetrahydro-2H-pyran-4-yl)oxy]benzoic acid is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with an iodine atom and an ether linkage to a tetrahydro-2H-pyran group. The presence of the iodine atom introduces unique reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The tetrahydro-2H-pyran moiety contributes to the compound's hydrophobic characteristics, influencing its solubility and biological activity. This compound is likely to exhibit moderate to high lipophilicity due to the presence of the cyclic ether, which can affect its pharmacokinetic properties. Additionally, the carboxylic acid functional group provides acidic characteristics, allowing for potential interactions in biological systems. Overall, 3-Iodo-4-[(tetrahydro-2H-pyran-4-yl)oxy]benzoic acid is a versatile compound with potential applications in various fields, including organic synthesis and drug development.
Formula:C12H13IO4
InChI:InChI=1S/C12H13IO4/c13-10-7-8(12(14)15)1-2-11(10)17-9-3-5-16-6-4-9/h1-2,7,9H,3-6H2,(H,14,15)
InChI key:InChIKey=LIBWGSSTTGAAHZ-UHFFFAOYSA-N
SMILES:O(C1=C(I)C=C(C(O)=O)C=C1)C2CCOCC2
Synonyms:- Benzoic acid, 3-iodo-4-[(tetrahydro-2H-pyran-4-yl)oxy]-
- 3-Iodo-4-[(tetrahydro-2H-pyran-4-yl)oxy]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
