CAS 1131614-81-7
:4-(4,4-Dimethyl-1-piperidinyl)-3-iodobenzoic acid
Description:
4-(4,4-Dimethyl-1-piperidinyl)-3-iodobenzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with an iodine atom and a piperidine ring. The presence of the iodine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The piperidine ring, with its dimethyl substitution, contributes to the compound's steric and electronic properties, potentially affecting its interaction with biological targets. This compound may exhibit properties such as lipophilicity due to the aromatic system and the piperidine's nitrogen atom, which can participate in hydrogen bonding. Its acid functionality allows for potential ionization, influencing solubility and reactivity in various environments. Overall, this compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C14H18INO2
InChI:InChI=1S/C14H18INO2/c1-14(2)5-7-16(8-6-14)12-4-3-10(13(17)18)9-11(12)15/h3-4,9H,5-8H2,1-2H3,(H,17,18)
InChI key:InChIKey=SHGVHBAFLCSMIV-UHFFFAOYSA-N
SMILES:IC1=C(C=CC(C(O)=O)=C1)N2CCC(C)(C)CC2
Synonyms:- 4-(4,4-Dimethyl-1-piperidinyl)-3-iodobenzoic acid
- Benzoic acid, 4-(4,4-dimethyl-1-piperidinyl)-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
