
CAS 1131614-83-9
:3-Iodo-4-[(2-methyl-1-piperidinyl)methyl]benzoic acid
Description:
3-Iodo-4-[(2-methyl-1-piperidinyl)methyl]benzoic acid is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with an iodine atom and a piperidine derivative. The presence of the iodine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The piperidine ring contributes to the compound's potential pharmacological properties, as piperidine derivatives are often associated with various biological activities, including analgesic and anti-inflammatory effects. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while its solubility in water can vary depending on the pH. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in drug development. Safety and handling precautions should be observed due to the presence of iodine and the potential for biological activity. As with any chemical substance, thorough characterization and analysis are essential for understanding its properties and applications.
Formula:C14H18INO2
InChI:InChI=1S/C14H18INO2/c1-10-4-2-3-7-16(10)9-12-6-5-11(14(17)18)8-13(12)15/h5-6,8,10H,2-4,7,9H2,1H3,(H,17,18)
InChI key:InChIKey=KPYKCFMYJUPGDR-UHFFFAOYSA-N
SMILES:C(C1=C(I)C=C(C(O)=O)C=C1)N2C(C)CCCC2
Synonyms:- Benzoic acid, 3-iodo-4-[(2-methyl-1-piperidinyl)methyl]-
- 3-Iodo-4-[(2-methyl-1-piperidinyl)methyl]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Iodo-4-((2-methylpiperidin-1-yl)methyl)benzoic acid
CAS:Formula:C14H18INO2Molecular weight:359.2027
