
CAS 1131614-88-4
:Ethyl 3-iodo-4-(4-morpholinyl)benzoate
Description:
Ethyl 3-iodo-4-(4-morpholinyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. The presence of the iodine atom at the 3-position of the aromatic ring contributes to its reactivity, making it a potential candidate for various chemical transformations. The morpholine moiety, attached at the 4-position, introduces a heterocyclic structure that can enhance solubility and biological activity. This compound is typically a solid or liquid at room temperature, depending on its specific formulation and purity. It is often utilized in medicinal chemistry and organic synthesis due to its ability to serve as an intermediate in the production of pharmaceuticals and agrochemicals. The compound's properties, such as solubility, melting point, and boiling point, can vary based on the specific conditions and purity levels. Safety data should be consulted for handling, as the presence of iodine and the morpholine group may pose specific health risks. Overall, Ethyl 3-iodo-4-(4-morpholinyl)benzoate is a versatile compound with significant applications in chemical research.
Formula:C13H16INO3
InChI:InChI=1S/C13H16INO3/c1-2-18-13(16)10-3-4-12(11(14)9-10)15-5-7-17-8-6-15/h3-4,9H,2,5-8H2,1H3
InChI key:InChIKey=HAEHRAFXUFJNFS-UHFFFAOYSA-N
SMILES:IC1=C(C=CC(C(OCC)=O)=C1)N2CCOCC2
Synonyms:- Ethyl 3-iodo-4-(4-morpholinyl)benzoate
- Benzoic acid, 3-iodo-4-(4-morpholinyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
