
CAS 1131614-89-5
:3-Iodo-4-[(tetrahydro-2H-pyran-4-yl)methoxy]benzoic acid
Description:
3-Iodo-4-[(tetrahydro-2H-pyran-4-yl)methoxy]benzoic acid is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with an iodine atom and a methoxy group linked to a tetrahydro-2H-pyran ring. This compound exhibits properties typical of benzoic acids, such as acidity due to the carboxylic acid functional group, and it may participate in hydrogen bonding due to the presence of the hydroxyl group. The iodine substitution can influence its reactivity and stability, potentially enhancing its lipophilicity and biological activity. The tetrahydro-2H-pyran moiety contributes to the compound's overall three-dimensional structure, which may affect its interactions in biological systems. This compound may be of interest in medicinal chemistry and drug development due to its unique structural features, which could lead to specific pharmacological properties. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be evaluated for various applications, including as a potential therapeutic agent.
Formula:C13H15IO4
InChI:InChI=1S/C13H15IO4/c14-11-7-10(13(15)16)1-2-12(11)18-8-9-3-5-17-6-4-9/h1-2,7,9H,3-6,8H2,(H,15,16)
InChI key:InChIKey=KZAVWQIURIGYIV-UHFFFAOYSA-N
SMILES:O(CC1CCOCC1)C2=C(I)C=C(C(O)=O)C=C2
Synonyms:- Benzoic acid, 3-iodo-4-[(tetrahydro-2H-pyran-4-yl)methoxy]-
- 3-Iodo-4-[(tetrahydro-2H-pyran-4-yl)methoxy]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Iodo-4-((tetrahydro-2H-pyran-4-yl)methoxy)benzoic acid
CAS:Formula:C13H15IO4Molecular weight:362.1603
