CAS 1131614-94-2
:4-[(2-Fluorophenyl)methoxy]-3-iodobenzoic acid
Description:
4-[(2-Fluorophenyl)methoxy]-3-iodobenzoic acid, identified by its CAS number 1131614-94-2, is a chemical compound characterized by its complex aromatic structure. It features a benzoic acid core substituted with a methoxy group and a 2-fluorophenyl moiety, as well as an iodine atom at the 3-position of the benzoic acid ring. This compound exhibits both hydrophobic and hydrophilic characteristics due to the presence of the aromatic rings and the carboxylic acid functional group, which can participate in hydrogen bonding. The fluorine atom enhances the compound's lipophilicity and may influence its biological activity. Its iodine substitution can also impart unique reactivity and stability properties. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. The specific interactions and reactivity of this compound can be further explored through various analytical techniques, including NMR and mass spectrometry, to elucidate its behavior in different chemical environments.
Formula:C14H10FIO3
InChI:InChI=1S/C14H10FIO3/c15-11-4-2-1-3-10(11)8-19-13-6-5-9(14(17)18)7-12(13)16/h1-7H,8H2,(H,17,18)
InChI key:InChIKey=WMFISHPEEJYFCA-UHFFFAOYSA-N
SMILES:O(CC1=C(F)C=CC=C1)C2=C(I)C=C(C(O)=O)C=C2
Synonyms:- 4-[(2-Fluorophenyl)methoxy]-3-iodobenzoic acid
- Benzoic acid, 4-[(2-fluorophenyl)methoxy]-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
