CAS 1131615-01-4

Benzoic acid, 3-bromo-4-propyl-

Description:

Benzoic acid, 3-bromo-4-propyl- is an aromatic carboxylic acid characterized by the presence of a bromine atom and a propyl group attached to the benzene ring. The bromine substituent is located at the meta position (3-position) relative to the carboxylic acid group, while the propyl group is at the para position (4-position). This compound exhibits typical properties of benzoic acids, including solubility in organic solvents and limited solubility in water due to its hydrophobic alkyl chain. The presence of the bromine atom can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution. Additionally, the carboxylic acid functional group contributes to its acidity and potential for forming salts and esters. This compound may also exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Overall, its unique structure imparts specific physical and chemical properties that can be exploited in various applications.

Formula: C₁₀H₁₁BrO₂

InChI: InChI=1S/C10H11BrO2/c1-2-3-7-4-5-8(10(12)13)6-9(7)11/h4-6H,2-3H2,1H3,(H,12,13)

InChI key: InChIKey=VLXUNAMNAIRVJU-UHFFFAOYSA-N

SMILES: C(CC)C1=C(Br)C=C(C(O)=O)C=C1

Synonyms:

• 3-Bromo-4-propylbenzoicacid
• Benzoic acid, 3-bromo-4-propyl-
• 3-Bromo-4-propylbenzoic acid

3-Bromo-4-propylbenzoic acid

CAS: 1131615-01-4

Formula: C₁₀H₁₁BrO₂

Purity: %

Color and Shape: Solid

Molecular weight: 243.0971

Ref: IN-DA00HCNN

3-Bromo-4-propylbenzoic acid

CAS: 1131615-01-4

3-Bromo-4-propylbenzoic acid

Purity: 95%

Molecular weight: 243.1g/mol

Ref: 54-OR1066970

3-Bromo-4-propylbenzoic acid

CAS: 1131615-01-4

Purity: 95+%

Molecular weight: 243.1000061

Ref: 10-F626802