CAS 1131615-06-9
:3-Bromo-4-butylbenzoic acid
Description:
3-Bromo-4-butylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and a butyl group attached to a benzoic acid framework. The bromine substituent is located at the meta position relative to the carboxylic acid group, while the butyl group is positioned at the para location. This compound exhibits typical properties of benzoic acids, including solubility in organic solvents and moderate solubility in water, influenced by the hydrophobic butyl group and the polar carboxylic acid functional group. The presence of the bromine atom can enhance the compound's reactivity, particularly in electrophilic substitution reactions. Additionally, the butyl group contributes to the compound's hydrophobic characteristics, which may affect its biological activity and interactions with other molecules. 3-Bromo-4-butylbenzoic acid may be utilized in various chemical syntheses and research applications, particularly in the development of pharmaceuticals and agrochemicals, due to its unique structural features and potential for functionalization.
Formula:C11H13BrO2
InChI:InChI=1S/C11H13BrO2/c1-2-3-4-8-5-6-9(11(13)14)7-10(8)12/h5-7H,2-4H2,1H3,(H,13,14)
InChI key:InChIKey=JGMIAEMRHOLOPC-UHFFFAOYSA-N
SMILES:C(CCC)C1=C(Br)C=C(C(O)=O)C=C1
Synonyms:- 3-Bromo-4-butylbenzoic acid
- Benzoic acid, 3-bromo-4-butyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
