CAS 1131615-09-2
:3-Bromo-4-[(1-methylethyl)amino]benzoic acid
Description:
3-Bromo-4-[(1-methylethyl)amino]benzoic acid is an organic compound characterized by its aromatic structure, which includes a bromine substituent and an isopropylamino group attached to a benzoic acid moiety. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The isopropylamino group contributes to the compound's basicity and can participate in hydrogen bonding, affecting its solubility in various solvents. As a benzoic acid derivative, it possesses a carboxylic acid functional group, which is known for its acidic properties. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The compound's characteristics, such as melting point, boiling point, and solubility, would depend on its specific interactions with solvents and other chemical entities. Overall, 3-Bromo-4-[(1-methylethyl)amino]benzoic acid is a versatile compound with potential implications in various chemical and biological contexts.
Formula:C10H12BrNO2
InChI:InChI=1S/C10H12BrNO2/c1-6(2)12-9-4-3-7(10(13)14)5-8(9)11/h3-6,12H,1-2H3,(H,13,14)
InChI key:InChIKey=HLTPBBNGJKFUHG-UHFFFAOYSA-N
SMILES:N(C(C)C)C1=C(Br)C=C(C(O)=O)C=C1
Synonyms:- 3-Bromo-4-[(1-methylethyl)amino]benzoic acid
- Benzoic acid, 3-bromo-4-[(1-methylethyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
