CAS 1131615-11-6
:3-Bromo-4-(2H-tetrazol-5-yl)benzoic acid
Description:
3-Bromo-4-(2H-tetrazol-5-yl)benzoic acid is an organic compound characterized by the presence of a bromine atom, a benzoic acid moiety, and a tetrazole ring. The bromine substituent is located at the meta position relative to the carboxylic acid group on the benzene ring, while the tetrazole group is attached at the para position. This compound exhibits both acidic and basic properties due to the carboxylic acid and tetrazole functionalities, respectively. It is likely to be soluble in polar solvents, given the presence of the carboxylic acid group, and may participate in hydrogen bonding. The tetrazole ring contributes to its potential biological activity, as tetrazoles are known for their pharmacological properties. Additionally, the presence of the bromine atom may enhance the compound's reactivity and influence its electronic properties. Overall, 3-Bromo-4-(2H-tetrazol-5-yl)benzoic acid is of interest in medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C8H5BrN4O2
InChI:InChI=1S/C8H5BrN4O2/c9-6-3-4(8(14)15)1-2-5(6)7-10-12-13-11-7/h1-3H,(H,14,15)(H,10,11,12,13)
InChI key:InChIKey=PPTCTJHIJVJYRQ-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC(C(O)=O)=C1)C=2NN=NN2
Synonyms:- Benzoic acid, 3-bromo-4-(2H-tetrazol-5-yl)-
- 3-Bromo-4-(2H-tetrazol-5-yl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
