CAS 1131615-13-8

3-Bromo-4-pentylbenzoic acid

Description:

3-Bromo-4-pentylbenzoic acid is an organic compound characterized by its aromatic structure, which includes a bromine substituent and a pentyl chain attached to a benzoic acid moiety. The presence of the bromine atom introduces a halogen functionality, which can influence the compound's reactivity and physical properties, such as solubility and boiling point. The pentyl group contributes to the hydrophobic character of the molecule, affecting its interactions in various environments, including biological systems. As a benzoic acid derivative, it possesses a carboxylic acid functional group, which is known for its acidic properties and ability to form hydrogen bonds. This compound may exhibit interesting properties in terms of its potential applications in materials science, pharmaceuticals, or as a chemical intermediate. Its specific reactivity and behavior would depend on the conditions of use, such as temperature, solvent, and the presence of other functional groups or catalysts. Overall, 3-Bromo-4-pentylbenzoic acid represents a versatile compound with potential utility in various chemical contexts.

Formula: C₁₂H₁₅BrO₂

InChI: InChI=1S/C12H15BrO2/c1-2-3-4-5-9-6-7-10(12(14)15)8-11(9)13/h6-8H,2-5H2,1H3,(H,14,15)

InChI key: InChIKey=MQFNWGDNZJKUFZ-UHFFFAOYSA-N

SMILES: C(CCCC)C1=C(Br)C=C(C(O)=O)C=C1

Synonyms:

• 3-Bromo-4-pentylbenzoic acid
• Benzoic acid, 3-bromo-4-pentyl-

3-Bromo-4-pentylbenzoic acid

CAS: 1131615-13-8

Formula: C₁₂H₁₅BrO₂

Molecular weight: 271.1503

Ref: IN-DA00HCNV