
CAS 113162-38-2
:5-Bromo-2,3-dihydro-N-methyl-1H-indole-6-sulfonamide
Description:
5-Bromo-2,3-dihydro-N-methyl-1H-indole-6-sulfonamide is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 5-position and a sulfonamide group at the 6-position contributes to its unique reactivity and potential biological activity. The N-methyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. This compound is typically used in medicinal chemistry and may exhibit various biological activities, including antimicrobial or anticancer properties. Its sulfonamide moiety is known for its role in inhibiting certain enzymes, making it a point of interest in drug design. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, and it may undergo various chemical reactions, including substitution and sulfonation. Overall, 5-Bromo-2,3-dihydro-N-methyl-1H-indole-6-sulfonamide is a versatile compound with potential applications in pharmaceutical research.
Formula:C9H11BrN2O2S
InChI:InChI=1S/C9H11BrN2O2S/c1-11-15(13,14)9-5-8-6(2-3-12-8)4-7(9)10/h4-5,11-12H,2-3H2,1H3
InChI key:InChIKey=IVBXJRHIMBPNKD-UHFFFAOYSA-N
SMILES:S(NC)(=O)(=O)C=1C=C2C(=CC1Br)CCN2
Synonyms:- 1H-Indole-6-sulfonamide, 5-bromo-2,3-dihydro-N-methyl-
- 5-Bromo-2,3-dihydro-N-methyl-1H-indole-6-sulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.