CymitQuimica logo

CAS 1131622-29-1

:

2,3-Dihydro-5-(1H-tetrazol-1-yl)-1H-inden-1-one

Description:
2,3-Dihydro-5-(1H-tetrazol-1-yl)-1H-inden-1-one is a chemical compound characterized by its unique bicyclic structure, which includes an indene moiety fused with a tetrazole ring. This compound typically exhibits properties such as moderate solubility in polar organic solvents, which can be attributed to the presence of the tetrazole group that enhances its polarity. The tetrazole ring is known for its ability to participate in various chemical reactions, making this compound potentially useful in medicinal chemistry and material science. Additionally, the presence of the carbonyl group in the indene structure may contribute to its reactivity, allowing for further functionalization. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of bioactive molecules. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, 2,3-Dihydro-5-(1H-tetrazol-1-yl)-1H-inden-1-one represents a versatile scaffold for further chemical exploration.
Formula:C10H8N4O
InChI:InChI=1S/C10H8N4O/c15-10-4-1-7-5-8(2-3-9(7)10)14-6-11-12-13-14/h2-3,5-6H,1,4H2
InChI key:InChIKey=FZYKWZHAQLCFPL-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(=CC2)N3C=NN=N3)CC1
Synonyms:
  • 1H-Inden-1-one, 2,3-dihydro-5-(1H-tetrazol-1-yl)-
  • 2,3-Dihydro-5-(1H-tetrazol-1-yl)-1H-inden-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.