CAS 1131622-30-4

4-(3-Butyl-1-piperazinyl)benzoic acid

Description:

4-(3-Butyl-1-piperazinyl)benzoic acid is a chemical compound characterized by its structure, which includes a benzoic acid moiety substituted with a piperazine ring that has a butyl group attached. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential solubility in various organic solvents. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions, potentially acting as a weak acid. The piperazine ring may impart basic characteristics, allowing for interactions with biological systems, which could be relevant in pharmaceutical applications. Additionally, the butyl group enhances hydrophobic interactions, influencing the compound's overall lipophilicity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or pathways. Its unique structural features could also lead to interesting biological activities, making it a candidate for further research in drug development and related fields.

Formula: C₁₅H₂₂N₂O₂

InChI: InChI=1S/C15H22N2O2/c1-2-3-4-13-11-17(10-9-16-13)14-7-5-12(6-8-14)15(18)19/h5-8,13,16H,2-4,9-11H2,1H3,(H,18,19)

InChI key: InChIKey=BARXREMNSHCFBW-UHFFFAOYSA-N

SMILES: C(CCC)C1CN(C2=CC=C(C(O)=O)C=C2)CCN1

Synonyms:

• Benzoic acid, 4-(3-butyl-1-piperazinyl)-
• 4-(3-Butyl-1-piperazinyl)benzoic acid