CAS 1131622-42-8
:Phenyl 2-hydroxy-5-iodobenzoate
Description:
Phenyl 2-hydroxy-5-iodobenzoate, identified by its CAS number 1131622-42-8, is an organic compound characterized by the presence of a phenyl group, a hydroxyl group, and an iodine atom attached to a benzoate structure. This compound typically exhibits properties associated with both aromatic and hydroxyl functionalities, which can influence its solubility and reactivity. The hydroxyl group contributes to its potential as a hydrogen bond donor, while the iodine substituent can enhance its reactivity in nucleophilic substitution reactions. The presence of the benzoate moiety suggests that it may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization in laboratory settings. Overall, its unique structural features make it a compound of interest in various chemical research fields.
Formula:C13H9IO3
InChI:InChI=1S/C13H9IO3/c14-9-6-7-12(15)11(8-9)13(16)17-10-4-2-1-3-5-10/h1-8,15H
InChI key:InChIKey=KOXUCLDCXDBNPY-UHFFFAOYSA-N
SMILES:C(OC1=CC=CC=C1)(=O)C2=C(O)C=CC(I)=C2
Synonyms:- Phenyl 2-hydroxy-5-iodobenzoate
- Benzoic acid, 2-hydroxy-5-iodo-, phenyl ester
- 2-hydroxy-5-iodobenzoic acid phenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
