CAS 1131622-43-9
:2-Phenylethyl 2-hydroxy-5-iodobenzoate
Description:
2-Phenylethyl 2-hydroxy-5-iodobenzoate is an organic compound characterized by its ester functional group, which is formed from the reaction of a phenolic compound and a carboxylic acid. This substance features a phenylethyl group, indicating the presence of a phenyl ring attached to an ethyl chain, contributing to its aromatic properties. The molecule also contains a hydroxyl group (-OH) and an iodine atom, which can influence its reactivity and solubility. The presence of the iodine atom may enhance its potential as a reagent in various chemical reactions, including nucleophilic substitutions. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting the compound's physical properties such as boiling point and solubility in polar solvents. Overall, 2-Phenylethyl 2-hydroxy-5-iodobenzoate is likely to exhibit moderate to high stability under standard conditions, with potential applications in organic synthesis and medicinal chemistry due to its unique structural features.
Formula:C15H13IO3
InChI:InChI=1S/C15H13IO3/c16-12-6-7-14(17)13(10-12)15(18)19-9-8-11-4-2-1-3-5-11/h1-7,10,17H,8-9H2
InChI key:InChIKey=AQHCKRARMXDFGU-UHFFFAOYSA-N
SMILES:C(OCCC1=CC=CC=C1)(=O)C2=C(O)C=CC(I)=C2
Synonyms:- 2-Phenylethyl 2-hydroxy-5-iodobenzoate
- Benzoic acid, 2-hydroxy-5-iodo-, 2-phenylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
