
CAS 1131622-45-1
:4-[2-(Acetylamino)ethyl]-3-iodobenzoic acid
Description:
4-[2-(Acetylamino)ethyl]-3-iodobenzoic acid, identified by its CAS number 1131622-45-1, is a chemical compound that features a benzoic acid core substituted with an iodine atom and an acetylaminoethyl side chain. This compound typically exhibits characteristics associated with both aromatic and carboxylic acid functionalities, which can influence its solubility and reactivity. The presence of the iodine atom may impart unique electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. The acetylamino group contributes to the compound's polar nature, which can affect its interaction with biological systems and solvents. As a benzoic acid derivative, it may exhibit acidic properties, allowing it to participate in acid-base reactions. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can engage in various biochemical interactions. Overall, this compound's unique structural features make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C11H12INO3
InChI:InChI=1S/C11H12INO3/c1-7(14)13-5-4-8-2-3-9(11(15)16)6-10(8)12/h2-3,6H,4-5H2,1H3,(H,13,14)(H,15,16)
InChI key:InChIKey=TUOKQFSQMAQKMG-UHFFFAOYSA-N
SMILES:C(CNC(C)=O)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:- 4-[2-(Acetylamino)ethyl]-3-iodobenzoic acid
- Benzoic acid, 4-[2-(acetylamino)ethyl]-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
