CAS 1131622-52-0
:3-Bromo-4-(2,2-dimethylpropoxy)benzoic acid
Description:
3-Bromo-4-(2,2-dimethylpropoxy)benzoic acid is an organic compound characterized by its aromatic structure, which includes a bromine substituent and a bulky alkoxy group. The presence of the bromine atom introduces both electrophilic and steric properties, influencing its reactivity and potential applications in synthesis. The 2,2-dimethylpropoxy group contributes to the compound's hydrophobic characteristics, affecting its solubility in various solvents. As a benzoic acid derivative, it features a carboxylic acid functional group, which can participate in acid-base reactions and may serve as a site for further chemical modifications. This compound may be of interest in pharmaceutical chemistry, agrochemicals, or materials science due to its unique structural features. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, 3-Bromo-4-(2,2-dimethylpropoxy)benzoic acid exemplifies the complexity of organic compounds and their potential utility in various chemical applications.
Formula:C12H15BrO3
InChI:InChI=1S/C12H15BrO3/c1-12(2,3)7-16-10-5-4-8(11(14)15)6-9(10)13/h4-6H,7H2,1-3H3,(H,14,15)
InChI key:InChIKey=CVQVLAWZKJCXOI-UHFFFAOYSA-N
SMILES:O(CC(C)(C)C)C1=C(Br)C=C(C(O)=O)C=C1
Synonyms:- 3-Bromo-4-(2,2-dimethylpropoxy)benzoic acid
- Benzoic acid, 3-bromo-4-(2,2-dimethylpropoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
