CymitQuimica logo

CAS 1131622-53-1

:

3-Bromo-4-(3-methyl-1-piperidinyl)benzoic acid

Description:
3-Bromo-4-(3-methyl-1-piperidinyl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a bromine substituent and a piperidine ring. The presence of the bromine atom introduces a halogen functionality, which can influence the compound's reactivity and solubility. The piperidine moiety, a six-membered nitrogen-containing ring, contributes to the compound's basicity and potential interactions with biological targets. This compound is typically classified as a benzoic acid derivative due to the carboxylic acid functional group (-COOH) attached to the benzene ring, which imparts acidic properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the piperidine ring is often found in various bioactive compounds. Additionally, the compound's unique combination of functional groups may allow for specific interactions in biological systems, making it a candidate for further research in drug development and synthesis.
Formula:C13H16BrNO2
InChI:InChI=1S/C13H16BrNO2/c1-9-3-2-6-15(8-9)12-5-4-10(13(16)17)7-11(12)14/h4-5,7,9H,2-3,6,8H2,1H3,(H,16,17)
InChI key:InChIKey=VKBVRCPGRKIKKT-UHFFFAOYSA-N
SMILES:BrC1=C(N2CC(C)CCC2)C=CC(C(O)=O)=C1
Synonyms:
  • 3-Bromo-4-(3-methyl-1-piperidinyl)benzoic acid
  • Benzoic acid, 3-bromo-4-(3-methyl-1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.