CAS 1131622-54-2
:Methyl 3-bromo-4-(3-piperidinyl)benzoate
Description:
Methyl 3-bromo-4-(3-piperidinyl)benzoate is an organic compound characterized by its structure, which includes a benzoate moiety substituted with a bromine atom and a piperidine ring. This compound features a methyl ester functional group, contributing to its solubility in organic solvents. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and potential applications in synthesis or medicinal chemistry. The piperidine group is a six-membered ring containing one nitrogen atom, which can impart basic properties and enhance biological activity. This compound may exhibit interesting pharmacological properties due to the combination of the aromatic system and the piperidine moiety, making it a candidate for further research in drug development. Its molecular interactions, stability, and reactivity can be influenced by the electronic effects of the bromine and the steric effects of the piperidine group. Overall, Methyl 3-bromo-4-(3-piperidinyl)benzoate represents a versatile structure in organic synthesis and medicinal chemistry.
Formula:C13H16BrNO2
InChI:InChI=1S/C13H16BrNO2/c1-17-13(16)9-4-5-11(12(14)7-9)10-3-2-6-15-8-10/h4-5,7,10,15H,2-3,6,8H2,1H3
InChI key:InChIKey=ZBGHTPCOWYYCAW-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC(C(OC)=O)=C1)C2CCCNC2
Synonyms:- Benzoic acid, 3-bromo-4-(3-piperidinyl)-, methyl ester
- Methyl 3-bromo-4-(3-piperidinyl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
