CymitQuimica logo

CAS 1131622-56-4

:

Methyl 3-bromo-4-(4-morpholinyl)benzoate

Description:
Methyl 3-bromo-4-(4-morpholinyl)benzoate is an organic compound characterized by its structure, which includes a benzoate moiety substituted with a bromine atom and a morpholine group. This compound typically appears as a solid or liquid, depending on the specific conditions, and is soluble in organic solvents. The presence of the bromine atom introduces electrophilic characteristics, making it reactive in various chemical reactions, such as nucleophilic substitutions. The morpholine group contributes to the compound's potential biological activity, as morpholines are often found in pharmaceuticals and agrochemicals due to their ability to interact with biological targets. Additionally, the ester functional group (benzoate) suggests that this compound may undergo hydrolysis under certain conditions, releasing methanol and the corresponding acid. Overall, Methyl 3-bromo-4-(4-morpholinyl)benzoate is of interest in synthetic organic chemistry and medicinal chemistry for its potential applications in drug development and as an intermediate in various chemical syntheses.
Formula:C12H14BrNO3
InChI:InChI=1S/C12H14BrNO3/c1-16-12(15)9-2-3-11(10(13)8-9)14-4-6-17-7-5-14/h2-3,8H,4-7H2,1H3
InChI key:InChIKey=LUCMWMVNYIUSOJ-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC(C(OC)=O)=C1)N2CCOCC2
Synonyms:
  • Benzoic acid, 3-bromo-4-(4-morpholinyl)-, methyl ester
  • Methyl 3-bromo-4-(4-morpholinyl)benzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.