
CAS 1131622-67-7
:Methyl 2-(3-methyl-1-piperazinyl)benzoate
Description:
Methyl 2-(3-methyl-1-piperazinyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and methyl alcohol. The presence of a piperazine ring, specifically a 3-methyl substitution, contributes to its unique chemical properties, including potential biological activity. This compound typically exhibits moderate solubility in organic solvents, while its solubility in water may vary depending on the pH and other conditions. Methyl 2-(3-methyl-1-piperazinyl)benzoate may be of interest in medicinal chemistry due to its structural features that could influence pharmacological interactions. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds targeting specific receptors or enzymes. Additionally, the compound's stability and reactivity can be influenced by the presence of functional groups, making it a candidate for further research in synthetic organic chemistry and related fields. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C13H18N2O2
InChI:InChI=1S/C13H18N2O2/c1-10-9-15(8-7-14-10)12-6-4-3-5-11(12)13(16)17-2/h3-6,10,14H,7-9H2,1-2H3
InChI key:InChIKey=ZTDQGCYWRDUEKR-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C=CC=C1)N2CC(C)NCC2
Synonyms:- Benzoic acid, 2-(3-methyl-1-piperazinyl)-, methyl ester
- Methyl 2-(3-methyl-1-piperazinyl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.