CAS 1131623-05-6

2-[(2-Methyl-1-piperazinyl)methyl]benzoic acid

Description:

2-[(2-Methyl-1-piperazinyl)methyl]benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety and a piperazine ring substituted with a methyl group. This compound typically exhibits properties associated with both aromatic and amine functionalities, contributing to its potential as a pharmacological agent. The presence of the benzoic acid group suggests it may have acidic properties, while the piperazine ring can impart basic characteristics, allowing for interactions with biological targets. The compound is likely to be soluble in polar solvents due to the presence of the carboxylic acid group, while the aromatic system may enhance lipophilicity. Its molecular structure may enable it to participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the piperazine moiety is often associated with various biological activities, making this compound of interest in medicinal chemistry and drug development. Overall, its unique combination of functional groups positions it as a potentially valuable compound in various chemical and pharmaceutical applications.

Formula: C₁₃H₁₈N₂O₂

InChI: InChI=1S/C13H18N2O2/c1-10-8-14-6-7-15(10)9-11-4-2-3-5-12(11)13(16)17/h2-5,10,14H,6-9H2,1H3,(H,16,17)

InChI key: InChIKey=DXVPRNVFYPAMNF-UHFFFAOYSA-N

SMILES: C(C1=C(C(O)=O)C=CC=C1)N2C(C)CNCC2

Synonyms:

• 2-[(2-Methyl-1-piperazinyl)methyl]benzoic acid
• Benzoic acid, 2-[(2-methyl-1-piperazinyl)methyl]-