CAS 1131623-12-5
:3-Aminotetrahydro-2H-pyran-3-carboxylic acid
Description:
3-Aminotetrahydro-2H-pyran-3-carboxylic acid is a chemical compound characterized by its bicyclic structure, which includes a pyran ring. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as a building block in organic synthesis and medicinal chemistry. The presence of these functional groups suggests that it may exhibit both basic and acidic properties, allowing it to participate in various chemical reactions, such as amide formation or esterification. The tetrahydro configuration indicates that the compound is saturated, which can influence its reactivity and stability. Additionally, the compound's molecular structure may allow for interactions with biological systems, making it of interest in pharmaceutical research. Its solubility and reactivity can vary depending on the pH and the presence of other functional groups in a reaction mixture. Overall, 3-Aminotetrahydro-2H-pyran-3-carboxylic acid is a versatile compound with potential applications in various fields, including drug development and organic synthesis.
Formula:C6H11NO3
InChI:InChI=1S/C6H11NO3/c7-6(5(8)9)2-1-3-10-4-6/h1-4,7H2,(H,8,9)
InChI key:InChIKey=RBDJRWBQJANLBU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(N)CCCOC1
Synonyms:- 3-Aminooxane-3-carboxylic acid
- 3-Aminotetrahydro-2H-pyran-3-carboxylic acid
- 2H-Pyran-3-carboxylic acid, 3-aminotetrahydro-
- 3-Amino-tetrahydropyrane-3-carboxylic acid
- 3-aminotetrahydro-2H-pyran-3-carboxylic acid hydrochloride
- 3-oxanecarboxylic acid amino ester
- 3-Aminotetrahydro-2H-pyran-3-carboxylicaci
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
