CAS 1131632-64-8

5,7-Dibromo-3-iodo-1H-indazole

Description:

5,7-Dibromo-3-iodo-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused five-membered and six-membered ring containing nitrogen atoms. The presence of two bromine atoms at the 5 and 7 positions, along with an iodine atom at the 3 position, contributes to its unique reactivity and physical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. Its halogen substituents can enhance its reactivity in various chemical reactions, making it of interest in synthetic organic chemistry and medicinal chemistry. The compound may also exhibit biological activity, which is often investigated in the context of drug development. Additionally, its molecular structure suggests potential applications in materials science and as a precursor for further chemical modifications. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₇H₃Br₂IN₂

InChI: InChI=1S/C7H3Br2IN2/c8-3-1-4-6(5(9)2-3)11-12-7(4)10/h1-2H,(H,11,12)

InChI key: InChIKey=ZIYLUJLIQSNNLD-UHFFFAOYSA-N

SMILES: BrC1=C2C(=CC(Br)=C1)C(I)=NN2

Synonyms:

• 1H-Indazole, 5,7-dibromo-3-iodo-
• 5,7-Dibromo-3-iodo-1H-indazole