CymitQuimica logo

CAS 113170-92-6

:

1-but-3-en-1-yl-4-(trifluoromethyl)benzene

Description:
1-but-3-en-1-yl-4-(trifluoromethyl)benzene, also known by its CAS number 113170-92-6, is an organic compound characterized by a benzene ring substituted with a trifluoromethyl group and a butenyl side chain. The presence of the trifluoromethyl group (-CF3) significantly influences its chemical properties, enhancing its lipophilicity and stability, while also imparting unique electronic characteristics that can affect reactivity and interaction with other molecules. The butenyl group introduces unsaturation, making the compound potentially reactive in addition reactions, particularly under conditions that favor alkene reactivity. This compound may exhibit interesting physical properties, such as a distinctive boiling point and solubility profile, influenced by the bulky trifluoromethyl group. Additionally, its structural features suggest potential applications in materials science, pharmaceuticals, or as an intermediate in organic synthesis. However, specific safety and handling guidelines should be followed due to the presence of fluorinated compounds, which can pose environmental and health risks.
Formula:C11H11F3
InChI:InChI=1/C11H11F3/c1-2-3-4-9-5-7-10(8-6-9)11(12,13)14/h2,5-8H,1,3-4H2
SMILES:C=CCCc1ccc(cc1)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.