CymitQuimica logo

CAS 1131737-03-5

:

(αS)-α-(Trifluoromethyl)cyclopropanemethanamine

Description:
(αS)-α-(Trifluoromethyl)cyclopropanemethanamine is a chemical compound characterized by its unique cyclopropane structure, which includes a trifluoromethyl group attached to the alpha position of the cyclopropane ring. This compound is notable for its potential applications in medicinal chemistry and as a building block in organic synthesis due to the presence of the trifluoromethyl group, which can enhance lipophilicity and metabolic stability. The stereochemistry indicated by the (αS) designation suggests that the compound has specific spatial arrangements of its atoms, which can significantly influence its biological activity and interaction with other molecules. The presence of the amine functional group also suggests potential reactivity, allowing for further derivatization or interaction with various reagents. Overall, this compound exemplifies the complexity and versatility of fluorinated organic compounds in chemical research and development.
Formula:C5H8F3N
InChI:InChI=1S/C5H8F3N/c6-5(7,8)4(9)3-1-2-3/h3-4H,1-2,9H2/t4-/m0/s1
InChI key:InChIKey=DMWCDCMZMZULIE-BYPYZUCNSA-N
SMILES:[C@H](C(F)(F)F)(N)C1CC1
Synonyms:
  • (αS)-α-(Trifluoromethyl)cyclopropanemethanamine
  • (1S)-1-Cyclopropyl-2,2,2-trifluoroethanamine
  • Cyclopropanemethanamine, α-(trifluoromethyl)-, (αS)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.